About 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide
2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide (PubChem CID 44613572) has the molecular formula C12H10N6OS
and a molecular weight of 286.32 g/mol. Its IUPAC name is 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide |
| PubChem CID | 44613572 |
| Molecular Formula | C12H10N6OS |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide |
| SMILES | Nc1ncc(C(=O)Nc2nc3ccccc3s2)c(N)n1 |
| InChI | InChI=1S/C12H10N6OS/c13-9-6(5-15-11(14)17-9)10(19)18-12-16-7-3-1-2-4-8(7)20-12/h1-5H,(H,16,18,19)(H4,13,14,15,17) |
| InChIKey | VVVCFARUYJZBGP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide?
The IUPAC name of 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide (CID 44613572) is 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide.
What is the SMILES notation for 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide?
The canonical SMILES for 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide is Nc1ncc(C(=O)Nc2nc3ccccc3s2)c(N)n1.
What is the InChIKey of 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide?
The InChIKey is VVVCFARUYJZBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N6OS/c13-9-6(5-15-11(14)17-9)10(19)18-12-16-7-3-1-2-4-8(7)20-12/h1-5H,(H,16,18,19)(H4,13,14,15,17).
What are the key properties of 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide?
2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide has a molecular weight of 286.32 g/mol, XLogP of 1.50, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-N-(1,3-benzothiazol-2-yl)pyrimidine-5-carboxamide is sourced from PubChem (CID 44613572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).