C29H54N6O8 — CID 44613834
tritert-butyl 10-[2-(ethylcarbamoylamino)propanoyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 44613834) has the molecular formula C29H54N6O8 and a molecular weight of 614.79 g/mol. Its IUPAC name is tritert-butyl 10-[2-(ethylcarbamoylamino)propanoyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | tritert-butyl 10-[2-(ethylcarbamoylamino)propanoyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 44613834 |
| Molecular Formula | C29H54N6O8 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.40 |
| IUPAC Name | tritert-butyl 10-[2-(ethylcarbamoylamino)propanoyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | CCNC(=O)NC(C)C(=O)N1CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C29H54N6O8/c1-12-30-23(37)31-21(2)22(36)32-13-15-33(24(38)41-27(3,4)5)17-19-35(26(40)43-29(9,10)11)20-18-34(16-14-32)25(39)42-28(6,7)8/h21H,12-20H2,1-11H3,(H2,30,31,37) |
| InChIKey | FPBFUIGPIJZLQT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|