C18H29NO3 — CID 44614067
2,4,6-tritert-butyl-4-[oxido(oxo)(15N)(15N)azaniumyl]cyclohexa-2,5-dien-1-one (PubChem CID 44614067) has the molecular formula C18H29NO3 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2,4,6-tritert-butyl-4-[oxido(oxo)(15N)(15N)azaniumyl]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,4,6-tritert-butyl-4-[oxido(oxo)(15N)(15N)azaniumyl]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 44614067 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2,4,6-tritert-butyl-4-[oxido(oxo)(15N)(15N)azaniumyl]cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC([15N+](=O)[O-])(C(C)(C)C)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H29NO3/c1-15(2,3)12-10-18(19(21)22,17(7,8)9)11-13(14(12)20)16(4,5)6/h10-11H,1-9H3/i19+1 |
| InChIKey | HOGNPJXNESBKGN-QHPTYGIKSA-N |
| XLogP | 4.58 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|