C17H13N3O3 — CID 44614080
methyl 3-cyano-4-hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate (PubChem CID 44614080) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is methyl 3-cyano-4-hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate.
| Compound Name | methyl 3-cyano-4-hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate |
|---|---|
| PubChem CID | 44614080 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | methyl 3-cyano-4-hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate |
| SMILES | COC(=O)c1cc2c3ccccc3n3c2c(n1)C(O)C(C#N)C3 |
| InChI | InChI=1S/C17H13N3O3/c1-23-17(22)12-6-11-10-4-2-3-5-13(10)20-8-9(7-18)16(21)14(19-12)15(11)20/h2-6,9,16,21H,8H2,1H3 |
| InChIKey | KRMHEOMGNWPNGO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |