C22H20Cl2N4O4 — CID 44614241
2-O-ethyl 7-O-methyl 6-amino-5,7-dicyano-8-(3,4-dichlorophenyl)-1,3,8,8a-tetrahydroisoquinoline-2,7-dicarboxylate (PubChem CID 44614241) has the molecular formula C22H20Cl2N4O4 and a molecular weight of 475.33 g/mol. Its IUPAC name is 2-O-ethyl 7-O-methyl 6-amino-5,7-dicyano-8-(3,4-dichlorophenyl)-1,3,8,8a-tetrahydroisoquinoline-2,7-dicarboxylate.
| Compound Name | 2-O-ethyl 7-O-methyl 6-amino-5,7-dicyano-8-(3,4-dichlorophenyl)-1,3,8,8a-tetrahydroisoquinoline-2,7-dicarboxylate |
|---|---|
| PubChem CID | 44614241 |
| Molecular Formula | C22H20Cl2N4O4 |
| Molecular Weight | 475.33 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 2-O-ethyl 7-O-methyl 6-amino-5,7-dicyano-8-(3,4-dichlorophenyl)-1,3,8,8a-tetrahydroisoquinoline-2,7-dicarboxylate |
| SMILES | CCOC(=O)N1CC=C2C(C#N)=C(N)C(C#N)(C(=O)OC)C(c3ccc(Cl)c(Cl)c3)C2C1 |
| InChI | InChI=1S/C22H20Cl2N4O4/c1-3-32-21(30)28-7-6-13-14(9-25)19(27)22(11-26,20(29)31-2)18(15(13)10-28)12-4-5-16(23)17(24)8-12/h4-6,8,15,18H,3,7,10,27H2,1-2H3 |
| InChIKey | NHGHBDAXSXYZPN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |