C12H16N6 — CID 44614379
2-[(3E)-3-hydrazinylidene-1-phenylbutyl]-1,2,4-triazol-3-amine (PubChem CID 44614379) has the molecular formula C12H16N6 and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-[(3E)-3-hydrazinylidene-1-phenylbutyl]-1,2,4-triazol-3-amine.
| Compound Name | 2-[(3E)-3-hydrazinylidene-1-phenylbutyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 44614379 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-[(3E)-3-hydrazinylidene-1-phenylbutyl]-1,2,4-triazol-3-amine |
| SMILES | C/C(CC(c1ccccc1)n1ncnc1N)=N\N |
| InChI | InChI=1S/C12H16N6/c1-9(17-14)7-11(10-5-3-2-4-6-10)18-12(13)15-8-16-18/h2-6,8,11H,7,14H2,1H3,(H2,13,15,16)/b17-9+ |
| InChIKey | JUJMEECTOBKPKV-RQZCQDPDSA-N |
| XLogP | 1.17 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|