About 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione
3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione (PubChem CID 44614384) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione.
Molecular Properties
| Compound Name | 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione |
| PubChem CID | 44614384 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione |
| SMILES | CNC1=CC(=O)c2c(cnc(C)c2C)C1=O |
| InChI | InChI=1S/C12H12N2O2/c1-6-7(2)14-5-8-11(6)10(15)4-9(13-3)12(8)16/h4-5,13H,1-3H3 |
| InChIKey | SDLNCVBYFYLESJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione?
The IUPAC name of 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione (CID 44614384) is 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione.
What is the SMILES notation for 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione?
The canonical SMILES for 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione is CNC1=CC(=O)c2c(cnc(C)c2C)C1=O.
What is the InChIKey of 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione?
The InChIKey is SDLNCVBYFYLESJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c1-6-7(2)14-5-8-11(6)10(15)4-9(13-3)12(8)16/h4-5,13H,1-3H3.
What are the key properties of 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione?
3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione has a molecular weight of 216.24 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione is sourced from PubChem (CID 44614384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).