About 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione
9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione (PubChem CID 44614507) has the molecular formula C22H14ClN3S
and a molecular weight of 387.90 g/mol. Its IUPAC name is 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione.
Molecular Properties
| Compound Name | 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione |
| PubChem CID | 44614507 |
| Molecular Formula | C22H14ClN3S |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione |
| SMILES | S=c1[nH]c2ccc(Cl)cc2c2nc(-c3ccccc3)c(-c3ccccc3)n12 |
| InChI | InChI=1S/C22H14ClN3S/c23-16-11-12-18-17(13-16)21-25-19(14-7-3-1-4-8-14)20(26(21)22(27)24-18)15-9-5-2-6-10-15/h1-13H,(H,24,27) |
| InChIKey | BOKDYJYXNSOBJY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione?
The IUPAC name of 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione (CID 44614507) is 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione.
What is the SMILES notation for 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione?
The canonical SMILES for 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione is S=c1[nH]c2ccc(Cl)cc2c2nc(-c3ccccc3)c(-c3ccccc3)n12.
What is the InChIKey of 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione?
The InChIKey is BOKDYJYXNSOBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14ClN3S/c23-16-11-12-18-17(13-16)21-25-19(14-7-3-1-4-8-14)20(26(21)22(27)24-18)15-9-5-2-6-10-15/h1-13H,(H,24,27).
What are the key properties of 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione?
9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione has a molecular weight of 387.90 g/mol, XLogP of 6.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-2,3-diphenyl-6H-imidazo[1,2-c]quinazoline-5-thione is sourced from PubChem (CID 44614507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).