About 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole
2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole (PubChem CID 44614542) has the molecular formula C22H16N4
and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole.
Molecular Properties
| Compound Name | 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole |
| PubChem CID | 44614542 |
| Molecular Formula | C22H16N4 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole |
| SMILES | c1ccc(-c2ccc(-c3[nH]c4ccccc4c3-n3cncn3)cc2)cc1 |
| InChI | InChI=1S/C22H16N4/c1-2-6-16(7-3-1)17-10-12-18(13-11-17)21-22(26-15-23-14-24-26)19-8-4-5-9-20(19)25-21/h1-15,25H |
| InChIKey | LZUXMPHQLVAWBZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole?
The IUPAC name of 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole (CID 44614542) is 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole.
What is the SMILES notation for 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole?
The canonical SMILES for 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole is c1ccc(-c2ccc(-c3[nH]c4ccccc4c3-n3cncn3)cc2)cc1.
What is the InChIKey of 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole?
The InChIKey is LZUXMPHQLVAWBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4/c1-2-6-16(7-3-1)17-10-12-18(13-11-17)21-22(26-15-23-14-24-26)19-8-4-5-9-20(19)25-21/h1-15,25H.
What are the key properties of 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole?
2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole has a molecular weight of 336.40 g/mol, XLogP of 5.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenylphenyl)-3-(1,2,4-triazol-1-yl)-1H-indole is sourced from PubChem (CID 44614542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).