C19H22O7 — CID 44614660
(1S,2R,10S,11R,12R,13R,14R,17R)-10,13-dihydroxy-2,6,11,17-tetramethyl-7,15-dioxapentacyclo[12.2.1.02,12.05,11.06,8]heptadec-4-ene-3,9,16-trione (PubChem CID 44614660) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is (1S,2R,10S,11R,12R,13R,14R,17R)-10,13-dihydroxy-2,6,11,17-tetramethyl-7,15-dioxapentacyclo[12.2.1.02,12.05,11.06,8]heptadec-4-ene-3,9,16-trione.
| Compound Name | (1S,2R,10S,11R,12R,13R,14R,17R)-10,13-dihydroxy-2,6,11,17-tetramethyl-7,15-dioxapentacyclo[12.2.1.02,12.05,11.06,8]heptadec-4-ene-3,9,16-trione |
|---|---|
| PubChem CID | 44614660 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (1S,2R,10S,11R,12R,13R,14R,17R)-10,13-dihydroxy-2,6,11,17-tetramethyl-7,15-dioxapentacyclo[12.2.1.02,12.05,11.06,8]heptadec-4-ene-3,9,16-trione |
| SMILES | C[C@H]1[C@H]2OC(=O)[C@@H]1[C@]1(C)C(=O)C=C3C4(C)OC4C(=O)[C@@H](O)[C@]3(C)[C@H]1[C@H]2O |
| InChI | InChI=1S/C19H22O7/c1-6-9-16(24)25-12(6)10(21)13-17(2)7(5-8(20)18(9,13)3)19(4)15(26-19)11(22)14(17)23/h5-6,9-10,12-15,21,23H,1-4H3/t6-,9-,10+,12-,13-,14-,15?,17+,18+,19?/m1/s1 |
| InChIKey | KKGVDBBMEXXFGZ-DAEDATHESA-N |
| XLogP | -0.22 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|