C19H24O7 — CID 44614661
(1S,2R,5R,9S,10S,11R,12R,13R,16R)-5,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadec-6-ene-3,8,15-trione (PubChem CID 44614661) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is (1S,2R,5R,9S,10S,11R,12R,13R,16R)-5,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadec-6-ene-3,8,15-trione.
| Compound Name | (1S,2R,5R,9S,10S,11R,12R,13R,16R)-5,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadec-6-ene-3,8,15-trione |
|---|---|
| PubChem CID | 44614661 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (1S,2R,5R,9S,10S,11R,12R,13R,16R)-5,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadec-6-ene-3,8,15-trione |
| SMILES | CC1=CC(=O)[C@@H](O)[C@]2(C)[C@H]3[C@@H](O)[C@@H]4OC(=O)[C@@H]([C@H]4C)[C@]3(C)C(=O)C[C@@]12O |
| InChI | InChI=1S/C19H24O7/c1-7-5-9(20)15(23)18(4)14-12(22)13-8(2)11(16(24)26-13)17(14,3)10(21)6-19(7,18)25/h5,8,11-15,22-23,25H,6H2,1-4H3/t8-,11-,12+,13-,14+,15-,17+,18+,19-/m1/s1 |
| InChIKey | FQVPJGXCVDLDQQ-SXIYMSMZSA-N |
| XLogP | -0.24 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |