About (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one
(2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one (PubChem CID 44614684) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one |
| PubChem CID | 44614684 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one |
| SMILES | C[C@H](CCCCC[C@H]1C=CC(=O)O1)[C@@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C18H30O4/c1-14(15(2)21-18-10-6-7-13-20-18)8-4-3-5-9-16-11-12-17(19)22-16/h11-12,14-16,18H,3-10,13H2,1-2H3/t14-,15-,16+,18?/m1/s1 |
| InChIKey | IWDLLHOWBPGOSV-LTBNCBHWSA-N |
| XLogP | 3.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one?
The IUPAC name of (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one (CID 44614684) is (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one.
What is the SMILES notation for (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one?
The canonical SMILES for (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one is C[C@H](CCCCC[C@H]1C=CC(=O)O1)[C@@H](C)OC1CCCCO1.
What is the InChIKey of (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one?
The InChIKey is IWDLLHOWBPGOSV-LTBNCBHWSA-N. The full InChI is InChI=1S/C18H30O4/c1-14(15(2)21-18-10-6-7-13-20-18)8-4-3-5-9-16-11-12-17(19)22-16/h11-12,14-16,18H,3-10,13H2,1-2H3/t14-,15-,16+,18?/m1/s1.
What are the key properties of (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one?
(2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one has a molecular weight of 310.43 g/mol, XLogP of 3.99, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(6R,7R)-6-methyl-7-(oxan-2-yloxy)octyl]-2H-furan-5-one is sourced from PubChem (CID 44614684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).