About 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one
3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one (PubChem CID 44614705) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one |
| PubChem CID | 44614705 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)CSC1C1=CCCN(C)C1 |
| InChI | InChI=1S/C11H18N2OS/c1-3-13-10(14)8-15-11(13)9-5-4-6-12(2)7-9/h5,11H,3-4,6-8H2,1-2H3 |
| InChIKey | JSXYTYAHKQRPIG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one?
The IUPAC name of 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one (CID 44614705) is 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one?
The canonical SMILES for 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one is CCN1C(=O)CSC1C1=CCCN(C)C1.
What is the InChIKey of 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one?
The InChIKey is JSXYTYAHKQRPIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-3-13-10(14)8-15-11(13)9-5-4-6-12(2)7-9/h5,11H,3-4,6-8H2,1-2H3.
What are the key properties of 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one?
3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one has a molecular weight of 226.34 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 44614705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).