C26H33N3O2S — CID 44614714
(1R,7R)-1-methyl-4-[2-(4-methylphenyl)imino-1,3-thiazepan-3-yl]-7-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 44614714) has the molecular formula C26H33N3O2S and a molecular weight of 451.64 g/mol. Its IUPAC name is (1R,7R)-1-methyl-4-[2-(4-methylphenyl)imino-1,3-thiazepan-3-yl]-7-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,7R)-1-methyl-4-[2-(4-methylphenyl)imino-1,3-thiazepan-3-yl]-7-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 44614714 |
| Molecular Formula | C26H33N3O2S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | (1R,7R)-1-methyl-4-[2-(4-methylphenyl)imino-1,3-thiazepan-3-yl]-7-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | Cc1ccc(/N=C2\SCCCCN2N2C(=O)C3C(C2=O)[C@@]2(C)C=C[C@]3(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C26H33N3O2S/c1-17(2)26-13-11-25(4,12-14-26)20-21(26)23(31)29(22(20)30)28-15-5-6-16-32-24(28)27-19-9-7-18(3)8-10-19/h7-11,13,17,20-21H,5-6,12,14-16H2,1-4H3/b27-24-/t20?,21?,25-,26+/m0/s1 |
| InChIKey | KDXBAIDZWXVDPI-TWUIOAMESA-N |
| XLogP | 5.34 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|