About diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate
diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate (PubChem CID 44614768) has the molecular formula C32H36N2O4
and a molecular weight of 512.65 g/mol. Its IUPAC name is diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate |
| PubChem CID | 44614768 |
| Molecular Formula | C32H36N2O4 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N(CCc2ccccc2)N(CCc2ccccc2)C1Cc1ccccc1 |
| InChI | InChI=1S/C32H36N2O4/c1-3-37-31(35)29-28(24-27-18-12-7-13-19-27)33(22-20-25-14-8-5-9-15-25)34(30(29)32(36)38-4-2)23-21-26-16-10-6-11-17-26/h5-19,28H,3-4,20-24H2,1-2H3 |
| InChIKey | OUDGHLCZFDBIEX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate?
The IUPAC name of diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate (CID 44614768) is diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate.
What is the SMILES notation for diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate?
The canonical SMILES for diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate is CCOC(=O)C1=C(C(=O)OCC)N(CCc2ccccc2)N(CCc2ccccc2)C1Cc1ccccc1.
What is the InChIKey of diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate?
The InChIKey is OUDGHLCZFDBIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H36N2O4/c1-3-37-31(35)29-28(24-27-18-12-7-13-19-27)33(22-20-25-14-8-5-9-15-25)34(30(29)32(36)38-4-2)23-21-26-16-10-6-11-17-26/h5-19,28H,3-4,20-24H2,1-2H3.
What are the key properties of diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate?
diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate has a molecular weight of 512.65 g/mol, XLogP of 5.00, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 3-benzyl-1,2-bis(2-phenylethyl)-3H-pyrazole-4,5-dicarboxylate is sourced from PubChem (CID 44614768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).