C21H19Cl2N3OS — CID 44615145
N-[2-(2,3-dichlorophenyl)imino-4-(4-methylphenyl)-3-prop-2-enyl-1,3-thiazol-5-yl]acetamide (PubChem CID 44615145) has the molecular formula C21H19Cl2N3OS and a molecular weight of 432.38 g/mol. Its IUPAC name is N-[2-(2,3-dichlorophenyl)imino-4-(4-methylphenyl)-3-prop-2-enyl-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-[2-(2,3-dichlorophenyl)imino-4-(4-methylphenyl)-3-prop-2-enyl-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 44615145 |
| Molecular Formula | C21H19Cl2N3OS |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | N-[2-(2,3-dichlorophenyl)imino-4-(4-methylphenyl)-3-prop-2-enyl-1,3-thiazol-5-yl]acetamide |
| SMILES | C=CCn1c(-c2ccc(C)cc2)c(NC(C)=O)s/c1=N\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H19Cl2N3OS/c1-4-12-26-19(15-10-8-13(2)9-11-15)20(24-14(3)27)28-21(26)25-17-7-5-6-16(22)18(17)23/h4-11H,1,12H2,2-3H3,(H,24,27)/b25-21- |
| InChIKey | NLZKYLLDXPJXAY-DAFNUICNSA-N |
| XLogP | 6.21 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|