C31H27Cl2N3O3S2 — CID 44615504
(5Z)-5-[[3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(3-ethoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 44615504) has the molecular formula C31H27Cl2N3O3S2 and a molecular weight of 624.62 g/mol. Its IUPAC name is (5Z)-5-[[3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(3-ethoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(3-ethoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 44615504 |
| Molecular Formula | C31H27Cl2N3O3S2 |
| Molecular Weight | 624.62 g/mol |
| Exact Mass | 623.09 |
| IUPAC Name | (5Z)-5-[[3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(3-ethoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOCCCN1C(=O)/C(=C/c2cn(-c3ccccc3)nc2-c2ccc(OCc3ccc(Cl)cc3Cl)cc2)SC1=S |
| InChI | InChI=1S/C31H27Cl2N3O3S2/c1-2-38-16-6-15-35-30(37)28(41-31(35)40)17-23-19-36(25-7-4-3-5-8-25)34-29(23)21-10-13-26(14-11-21)39-20-22-9-12-24(32)18-27(22)33/h3-5,7-14,17-19H,2,6,15-16,20H2,1H3/b28-17- |
| InChIKey | ORWYRGVSVGZWRL-QRQIAZFYSA-N |
| XLogP | 8.05 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.62 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|