C16H19N5O3S — CID 44615595
4-[[6-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine (PubChem CID 44615595) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is 4-[[6-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine.
| Compound Name | 4-[[6-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 44615595 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-[[6-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine |
| SMILES | COc1ccc(-c2nn3c(CN4CCOCC4)nnc3s2)cc1OC |
| InChI | InChI=1S/C16H19N5O3S/c1-22-12-4-3-11(9-13(12)23-2)15-19-21-14(17-18-16(21)25-15)10-20-5-7-24-8-6-20/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | SIKNWOUOPJWTGI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |