About 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine
2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine (PubChem CID 44620913) has the molecular formula C20H18N4O2S
and a molecular weight of 378.46 g/mol. Its IUPAC name is 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine.
Molecular Properties
| Compound Name | 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
| PubChem CID | 44620913 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
| SMILES | COc1cccc(CSc2nnc(-c3ccccn3)n2Cc2ccco2)c1 |
| InChI | InChI=1S/C20H18N4O2S/c1-25-16-7-4-6-15(12-16)14-27-20-23-22-19(18-9-2-3-10-21-18)24(20)13-17-8-5-11-26-17/h2-12H,13-14H2,1H3 |
| InChIKey | QSNSXXYUVFWBMF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine?
The IUPAC name of 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine (CID 44620913) is 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine.
What is the SMILES notation for 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine?
The canonical SMILES for 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine is COc1cccc(CSc2nnc(-c3ccccn3)n2Cc2ccco2)c1.
What is the InChIKey of 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine?
The InChIKey is QSNSXXYUVFWBMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2S/c1-25-16-7-4-6-15(12-16)14-27-20-23-22-19(18-9-2-3-10-21-18)24(20)13-17-8-5-11-26-17/h2-12H,13-14H2,1H3.
What are the key properties of 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine?
2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine has a molecular weight of 378.46 g/mol, XLogP of 4.28, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(furan-2-ylmethyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine is sourced from PubChem (CID 44620913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).