C18H19N3O5 — CID 44620950
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(4-naphthalen-1-yltriazol-1-yl)oxane-3,4,5-triol (PubChem CID 44620950) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(4-naphthalen-1-yltriazol-1-yl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(4-naphthalen-1-yltriazol-1-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 44620950 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(4-naphthalen-1-yltriazol-1-yl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](n2cc(-c3cccc4ccccc34)nn2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19N3O5/c22-9-14-15(23)16(24)17(25)18(26-14)21-8-13(19-20-21)12-7-3-5-10-4-1-2-6-11(10)12/h1-8,14-18,22-25H,9H2/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | ZQSWMZLNZOWSSB-UYTYNIKBSA-N |
| XLogP | 0.07 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |