C19H14F6N2O3S2 — CID 44621135
4-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-ethyl-1,3-thiazol-2-ylidene]amino]benzenesulfonic acid (PubChem CID 44621135) has the molecular formula C19H14F6N2O3S2 and a molecular weight of 496.45 g/mol. Its IUPAC name is 4-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-ethyl-1,3-thiazol-2-ylidene]amino]benzenesulfonic acid.
| Compound Name | 4-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-ethyl-1,3-thiazol-2-ylidene]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 44621135 |
| Molecular Formula | C19H14F6N2O3S2 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | 4-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-ethyl-1,3-thiazol-2-ylidene]amino]benzenesulfonic acid |
| SMILES | CCn1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cs/c1=N\c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H14F6N2O3S2/c1-2-27-16(11-7-12(18(20,21)22)9-13(8-11)19(23,24)25)10-31-17(27)26-14-3-5-15(6-4-14)32(28,29)30/h3-10H,2H2,1H3,(H,28,29,30)/b26-17- |
| InChIKey | JWDDGAHUHYQMNZ-ONUIUJJFSA-N |
| XLogP | 5.75 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|