C20H23FN4O2 — CID 44621164
N-butyl-2-[1-ethyl-6-(3-fluorophenyl)-2-oxoimidazo[4,5-b]pyridin-3-yl]acetamide (PubChem CID 44621164) has the molecular formula C20H23FN4O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is N-butyl-2-[1-ethyl-6-(3-fluorophenyl)-2-oxoimidazo[4,5-b]pyridin-3-yl]acetamide.
| Compound Name | N-butyl-2-[1-ethyl-6-(3-fluorophenyl)-2-oxoimidazo[4,5-b]pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 44621164 |
| Molecular Formula | C20H23FN4O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-butyl-2-[1-ethyl-6-(3-fluorophenyl)-2-oxoimidazo[4,5-b]pyridin-3-yl]acetamide |
| SMILES | CCCCNC(=O)Cn1c(=O)n(CC)c2cc(-c3cccc(F)c3)cnc21 |
| InChI | InChI=1S/C20H23FN4O2/c1-3-5-9-22-18(26)13-25-19-17(24(4-2)20(25)27)11-15(12-23-19)14-7-6-8-16(21)10-14/h6-8,10-12H,3-5,9,13H2,1-2H3,(H,22,26) |
| InChIKey | DNWMPSWHSXOKKO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|