C30H35N7O4 — CID 44621417
17,26-dimethyl-20,23-dioxa-4,12,14,17,26,29,31-heptazahexacyclo[27.6.1.17,14.02,6.08,13.030,35]heptatriaconta-1(36),2(6),7(37),8(13),9,11,30(35),31,33-nonaene-3,5-dione (PubChem CID 44621417) has the molecular formula C30H35N7O4 and a molecular weight of 557.66 g/mol. Its IUPAC name is 17,26-dimethyl-20,23-dioxa-4,12,14,17,26,29,31-heptazahexacyclo[27.6.1.17,14.02,6.08,13.030,35]heptatriaconta-1(36),2(6),7(37),8(13),9,11,30(35),31,33-nonaene-3,5-dione.
| Compound Name | 17,26-dimethyl-20,23-dioxa-4,12,14,17,26,29,31-heptazahexacyclo[27.6.1.17,14.02,6.08,13.030,35]heptatriaconta-1(36),2(6),7(37),8(13),9,11,30(35),31,33-nonaene-3,5-dione |
|---|---|
| PubChem CID | 44621417 |
| Molecular Formula | C30H35N7O4 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 17,26-dimethyl-20,23-dioxa-4,12,14,17,26,29,31-heptazahexacyclo[27.6.1.17,14.02,6.08,13.030,35]heptatriaconta-1(36),2(6),7(37),8(13),9,11,30(35),31,33-nonaene-3,5-dione |
| SMILES | CN1CCOCCOCCN(C)CCn2cc(c3cccnc32)C2=C(C(=O)NC2=O)c2cn(c3ncccc23)CC1 |
| InChI | InChI=1S/C30H35N7O4/c1-34-9-11-36-19-23(21-5-3-7-31-27(21)36)25-26(30(39)33-29(25)38)24-20-37(28-22(24)6-4-8-32-28)12-10-35(2)14-16-41-18-17-40-15-13-34/h3-8,19-20H,9-18H2,1-2H3,(H,33,38,39) |
| InChIKey | QRQFMCHEVJYCSY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|