C25H26ClN7 — CID 44621650
5-chloro-2-N-[2,5-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)phenyl]-4-N-(5-methyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine (PubChem CID 44621650) has the molecular formula C25H26ClN7 and a molecular weight of 459.99 g/mol. Its IUPAC name is 5-chloro-2-N-[2,5-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)phenyl]-4-N-(5-methyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[2,5-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)phenyl]-4-N-(5-methyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44621650 |
| Molecular Formula | C25H26ClN7 |
| Molecular Weight | 459.99 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 5-chloro-2-N-[2,5-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)phenyl]-4-N-(5-methyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2nc(Nc3cc(C)c(-c4ccc5c(c4)CCNC5)cc3C)ncc2Cl)n[nH]1 |
| InChI | InChI=1S/C25H26ClN7/c1-14-9-22(15(2)8-20(14)18-4-5-19-12-27-7-6-17(19)11-18)29-25-28-13-21(26)24(31-25)30-23-10-16(3)32-33-23/h4-5,8-11,13,27H,6-7,12H2,1-3H3,(H3,28,29,30,31,32,33) |
| InChIKey | XCLDNKHRMVDMJP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.99 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |