C28H24F4N10 — CID 44622169
6-[6-(cyclopropylamino)-5-fluoro-3-pyridinyl]-2-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]-4-N-[1-(trifluoromethyl)cyclopropyl]pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 44622169) has the molecular formula C28H24F4N10 and a molecular weight of 576.56 g/mol. Its IUPAC name is 6-[6-(cyclopropylamino)-5-fluoro-3-pyridinyl]-2-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]-4-N-[1-(trifluoromethyl)cyclopropyl]pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 6-[6-(cyclopropylamino)-5-fluoro-3-pyridinyl]-2-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]-4-N-[1-(trifluoromethyl)cyclopropyl]pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44622169 |
| Molecular Formula | C28H24F4N10 |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 6-[6-(cyclopropylamino)-5-fluoro-3-pyridinyl]-2-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]-4-N-[1-(trifluoromethyl)cyclopropyl]pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | Fc1cc(-c2ccc3nc(NCc4cccc(-n5cncn5)c4)nc(NC4(C(F)(F)F)CC4)c3n2)cnc1NC1CC1 |
| InChI | InChI=1S/C28H24F4N10/c29-20-11-17(13-34-24(20)37-18-4-5-18)21-6-7-22-23(38-21)25(41-27(8-9-27)28(30,31)32)40-26(39-22)35-12-16-2-1-3-19(10-16)42-15-33-14-36-42/h1-3,6-7,10-11,13-15,18H,4-5,8-9,12H2,(H,34,37)(H2,35,39,40,41) |
| InChIKey | QFEMUJKMNIOPSD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |