About (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one
(4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one (PubChem CID 44622626) has the molecular formula C16H20Cl2N2O2
and a molecular weight of 343.25 g/mol. Its IUPAC name is (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one.
Molecular Properties
| Compound Name | (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one |
| PubChem CID | 44622626 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one |
| SMILES | CO/N=C(/CCC(=O)N1CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-22-19-15(12-5-6-13(17)14(18)11-12)7-8-16(21)20-9-3-2-4-10-20/h5-6,11H,2-4,7-10H2,1H3/b19-15- |
| InChIKey | JRCISARFEYMWLW-CYVLTUHYSA-N |
| XLogP | 4.14 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one?
The IUPAC name of (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one (CID 44622626) is (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one.
What is the SMILES notation for (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one?
The canonical SMILES for (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one is CO/N=C(/CCC(=O)N1CCCCC1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one?
The InChIKey is JRCISARFEYMWLW-CYVLTUHYSA-N. The full InChI is InChI=1S/C16H20Cl2N2O2/c1-22-19-15(12-5-6-13(17)14(18)11-12)7-8-16(21)20-9-3-2-4-10-20/h5-6,11H,2-4,7-10H2,1H3/b19-15-.
What are the key properties of (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one?
(4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one has a molecular weight of 343.25 g/mol, XLogP of 4.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-1-piperidin-1-ylbutan-1-one is sourced from PubChem (CID 44622626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).