C13HF9N2 — CID 44622822
4,5,6,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)-2H-indazole (PubChem CID 44622822) has the molecular formula C13HF9N2 and a molecular weight of 356.15 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)-2H-indazole.
| Compound Name | 4,5,6,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)-2H-indazole |
|---|---|
| PubChem CID | 44622822 |
| Molecular Formula | C13HF9N2 |
| Molecular Weight | 356.15 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 4,5,6,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)-2H-indazole |
| SMILES | Fc1c(F)c(F)c(-c2[nH]nc3c(F)c(F)c(F)c(F)c23)c(F)c1F |
| InChI | InChI=1S/C13HF9N2/c14-3-1(4(15)7(18)9(20)6(3)17)12-2-5(16)8(19)10(21)11(22)13(2)24-23-12/h(H,23,24) |
| InChIKey | BLRLNVDCKOMIHM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.15 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|