C11H10N2S2 — CID 44623002
3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazine-6-thione (PubChem CID 44623002) has the molecular formula C11H10N2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazine-6-thione.
| Compound Name | 3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazine-6-thione |
|---|---|
| PubChem CID | 44623002 |
| Molecular Formula | C11H10N2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazine-6-thione |
| SMILES | S=C1Sc2ccccc2C2=NCCCN12 |
| InChI | InChI=1S/C11H10N2S2/c14-11-13-7-3-6-12-10(13)8-4-1-2-5-9(8)15-11/h1-2,4-5H,3,6-7H2 |
| InChIKey | NPBNYYVWCOBLJR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|