About 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole
1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole (PubChem CID 44623032) has the molecular formula C32H26N4
and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole.
Molecular Properties
| Compound Name | 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole |
| PubChem CID | 44623032 |
| Molecular Formula | C32H26N4 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole |
| SMILES | Cn1c(-c2nc(-c3ccccc3)c(-c3ccccc3)n2C)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C32H26N4/c1-35-29(25-19-11-5-12-20-25)27(23-15-7-3-8-16-23)33-31(35)32-34-28(24-17-9-4-10-18-24)30(36(32)2)26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChIKey | LXSHRAUPBBLJTI-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole?
The IUPAC name of 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole (CID 44623032) is 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole.
What is the SMILES notation for 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole?
The canonical SMILES for 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole is Cn1c(-c2nc(-c3ccccc3)c(-c3ccccc3)n2C)nc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole?
The InChIKey is LXSHRAUPBBLJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H26N4/c1-35-29(25-19-11-5-12-20-25)27(23-15-7-3-8-16-23)33-31(35)32-34-28(24-17-9-4-10-18-24)30(36(32)2)26-21-13-6-14-22-26/h3-22H,1-2H3.
What are the key properties of 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole?
1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole has a molecular weight of 466.59 g/mol, XLogP of 7.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(1-methyl-4,5-diphenylimidazol-2-yl)-4,5-diphenylimidazole is sourced from PubChem (CID 44623032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).