3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid

C15H13NO3 — CID 44623061

IUPAC3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid
SMILESO=C(O)c1cc2occ(CCc3ccccc3)c2[nH]1
InChIInChI=1S/C15H13NO3/c17-15(18)12-8-13-14(16-12)11(9-19-13)7-6-10-4-2-1-3-5-10/h1-5,8-9,16H,6-7H2,(H,17,18)
InChIKeyCUCMYHOPTSUPIM-UHFFFAOYSA-N
MW255.27 g/mol
LogP3.24
Rot. Bonds4

About 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid

3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 44623061) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid.

Molecular Properties

Compound Name3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid
PubChem CID44623061
Molecular FormulaC15H13NO3
Molecular Weight255.27 g/mol
Exact Mass255.09
IUPAC Name3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid
SMILESO=C(O)c1cc2occ(CCc3ccccc3)c2[nH]1
InChIInChI=1S/C15H13NO3/c17-15(18)12-8-13-14(16-12)11(9-19-13)7-6-10-4-2-1-3-5-10/h1-5,8-9,16H,6-7H2,(H,17,18)
InChIKeyCUCMYHOPTSUPIM-UHFFFAOYSA-N
XLogP3.24
TPSA66.23 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.27
LogP ≤ 53.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid (CID 44623061) is 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid is O=C(O)c1cc2occ(CCc3ccccc3)c2[nH]1.
What is the InChIKey of 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is CUCMYHOPTSUPIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c17-15(18)12-8-13-14(16-12)11(9-19-13)7-6-10-4-2-1-3-5-10/h1-5,8-9,16H,6-7H2,(H,17,18).
What are the key properties of 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 255.27 g/mol, XLogP of 3.24, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenylethyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 44623061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).