C15H19N3S — CID 44623089
N-tert-butyl-3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine (PubChem CID 44623089) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is N-tert-butyl-3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine.
| Compound Name | N-tert-butyl-3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine |
|---|---|
| PubChem CID | 44623089 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-tert-butyl-3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine |
| SMILES | CC(C)(C)/N=C1\Sc2ccccc2C2=NCCCN21 |
| InChI | InChI=1S/C15H19N3S/c1-15(2,3)17-14-18-10-6-9-16-13(18)11-7-4-5-8-12(11)19-14/h4-5,7-8H,6,9-10H2,1-3H3/b17-14- |
| InChIKey | HBCXNFXNUDXJPN-VKAVYKQESA-N |
| XLogP | 3.40 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|