C21H22N4O3 — CID 44623133
2-(2-aminophenyl)-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)oxan-4-yl]benzoic acid (PubChem CID 44623133) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-(2-aminophenyl)-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)oxan-4-yl]benzoic acid.
| Compound Name | 2-(2-aminophenyl)-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)oxan-4-yl]benzoic acid |
|---|---|
| PubChem CID | 44623133 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-(2-aminophenyl)-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)oxan-4-yl]benzoic acid |
| SMILES | Cc1nc(C2(c3ccc(C(=O)O)c(-c4ccccc4N)c3)CCOCC2)n[nH]1 |
| InChI | InChI=1S/C21H22N4O3/c1-13-23-20(25-24-13)21(8-10-28-11-9-21)14-6-7-16(19(26)27)17(12-14)15-4-2-3-5-18(15)22/h2-7,12H,8-11,22H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | HDCXAOUBUQIONG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|