About 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine
4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine (PubChem CID 44623244) has the molecular formula C17H13N5
and a molecular weight of 287.33 g/mol. Its IUPAC name is 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine |
| PubChem CID | 44623244 |
| Molecular Formula | C17H13N5 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2c[nH]c3ncc(-c4ccccc4)cc23)n1 |
| InChI | InChI=1S/C17H13N5/c18-17-19-7-6-15(22-17)14-10-21-16-13(14)8-12(9-20-16)11-4-2-1-3-5-11/h1-10H,(H,20,21)(H2,18,19,22) |
| InChIKey | KPJMUYKZCGYCGA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine?
The IUPAC name of 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine (CID 44623244) is 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine.
What is the SMILES notation for 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine?
The canonical SMILES for 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine is Nc1nccc(-c2c[nH]c3ncc(-c4ccccc4)cc23)n1.
What is the InChIKey of 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine?
The InChIKey is KPJMUYKZCGYCGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N5/c18-17-19-7-6-15(22-17)14-10-21-16-13(14)8-12(9-20-16)11-4-2-1-3-5-11/h1-10H,(H,20,21)(H2,18,19,22).
What are the key properties of 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine?
4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine has a molecular weight of 287.33 g/mol, XLogP of 3.27, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine is sourced from PubChem (CID 44623244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).