C21H18N4O2S — CID 44623259
N-hydroxy-3-[1-[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]cyclopropyl]benzamide (PubChem CID 44623259) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-hydroxy-3-[1-[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]cyclopropyl]benzamide.
| Compound Name | N-hydroxy-3-[1-[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]cyclopropyl]benzamide |
|---|---|
| PubChem CID | 44623259 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-hydroxy-3-[1-[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]cyclopropyl]benzamide |
| SMILES | Cc1nc2ccccn2c1-c1csc(C2(c3cccc(C(=O)NO)c3)CC2)n1 |
| InChI | InChI=1S/C21H18N4O2S/c1-13-18(25-10-3-2-7-17(25)22-13)16-12-28-20(23-16)21(8-9-21)15-6-4-5-14(11-15)19(26)24-27/h2-7,10-12,27H,8-9H2,1H3,(H,24,26) |
| InChIKey | NKDOAXVJZMNOFS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|