About methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate
methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 44623370) has the molecular formula C12H10ClNO3
and a molecular weight of 251.67 g/mol. Its IUPAC name is methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate |
| PubChem CID | 44623370 |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccccc2)oc1CCl |
| InChI | InChI=1S/C12H10ClNO3/c1-16-12(15)10-9(7-13)17-11(14-10)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | HSKFIZLWESPZMQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate (CID 44623370) is methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate is COC(=O)c1nc(-c2ccccc2)oc1CCl.
What is the InChIKey of methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate?
The InChIKey is HSKFIZLWESPZMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO3/c1-16-12(15)10-9(7-13)17-11(14-10)8-5-3-2-4-6-8/h2-6H,7H2,1H3.
What are the key properties of methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate?
methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate has a molecular weight of 251.67 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(chloromethyl)-2-phenyl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 44623370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).