C34H26O8 — CID 44623463
bis(2-phenylethyl) 4,5,10-trihydroxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-15,16-dicarboxylate (PubChem CID 44623463) has the molecular formula C34H26O8 and a molecular weight of 562.57 g/mol. Its IUPAC name is bis(2-phenylethyl) 4,5,10-trihydroxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-15,16-dicarboxylate.
| Compound Name | bis(2-phenylethyl) 4,5,10-trihydroxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-15,16-dicarboxylate |
|---|---|
| PubChem CID | 44623463 |
| Molecular Formula | C34H26O8 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | bis(2-phenylethyl) 4,5,10-trihydroxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-15,16-dicarboxylate |
| SMILES | O=C(OCCc1ccccc1)c1cc2ccc(O)c3c2c(c1C(=O)OCCc1ccccc1)-c1cc(O)c(O)cc1O3 |
| InChI | InChI=1S/C34H26O8/c35-25-12-11-22-17-24(33(38)40-15-13-20-7-3-1-4-8-20)31(34(39)41-16-14-21-9-5-2-6-10-21)30-23-18-26(36)27(37)19-28(23)42-32(25)29(22)30/h1-12,17-19,35-37H,13-16H2 |
| InChIKey | QNAMZKYXGYBYOC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|