C40H32O11 — CID 44623464
bis(2-phenylethyl) 4,5,10-triacetyloxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-15,16-dicarboxylate (PubChem CID 44623464) has the molecular formula C40H32O11 and a molecular weight of 688.69 g/mol. Its IUPAC name is bis(2-phenylethyl) 4,5,10-triacetyloxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-15,16-dicarboxylate.
| Compound Name | bis(2-phenylethyl) 4,5,10-triacetyloxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-15,16-dicarboxylate |
|---|---|
| PubChem CID | 44623464 |
| Molecular Formula | C40H32O11 |
| Molecular Weight | 688.69 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | bis(2-phenylethyl) 4,5,10-triacetyloxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-15,16-dicarboxylate |
| SMILES | CC(=O)Oc1cc2c(cc1OC(C)=O)-c1c(C(=O)OCCc3ccccc3)c(C(=O)OCCc3ccccc3)cc3ccc(OC(C)=O)c(c13)O2 |
| InChI | InChI=1S/C40H32O11/c1-23(41)48-31-15-14-28-20-30(39(44)46-18-16-26-10-6-4-7-11-26)37(40(45)47-19-17-27-12-8-5-9-13-27)36-29-21-33(49-24(2)42)34(50-25(3)43)22-32(29)51-38(31)35(28)36/h4-15,20-22H,16-19H2,1-3H3 |
| InChIKey | LFPUYCXPVBWHAO-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.69 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|