C29H27N5O2S — CID 44623556
N-(2-aminophenyl)-4-[4-(4-imidazo[1,2-a]pyridin-3-yl-5-methyl-1,3-thiazol-2-yl)oxan-4-yl]benzamide (PubChem CID 44623556) has the molecular formula C29H27N5O2S and a molecular weight of 509.64 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[4-(4-imidazo[1,2-a]pyridin-3-yl-5-methyl-1,3-thiazol-2-yl)oxan-4-yl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[4-(4-imidazo[1,2-a]pyridin-3-yl-5-methyl-1,3-thiazol-2-yl)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 44623556 |
| Molecular Formula | C29H27N5O2S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[4-(4-imidazo[1,2-a]pyridin-3-yl-5-methyl-1,3-thiazol-2-yl)oxan-4-yl]benzamide |
| SMILES | Cc1sc(C2(c3ccc(C(=O)Nc4ccccc4N)cc3)CCOCC2)nc1-c1cnc2ccccn12 |
| InChI | InChI=1S/C29H27N5O2S/c1-19-26(24-18-31-25-8-4-5-15-34(24)25)33-28(37-19)29(13-16-36-17-14-29)21-11-9-20(10-12-21)27(35)32-23-7-3-2-6-22(23)30/h2-12,15,18H,13-14,16-17,30H2,1H3,(H,32,35) |
| InChIKey | JIUMHRZOADUKLF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|