About 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid
2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 44623582) has the molecular formula C12H23N3O5
and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid |
| PubChem CID | 44623582 |
| Molecular Formula | C12H23N3O5 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCO)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C12H23N3O5/c16-8-7-13-1-3-14(9-11(17)18)5-6-15(4-2-13)10-12(19)20/h16H,1-10H2,(H,17,18)(H,19,20) |
| InChIKey | FTNFWONNBSJYFU-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid?
The IUPAC name of 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid (CID 44623582) is 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid is O=C(O)CN1CCN(CCO)CCN(CC(=O)O)CC1.
What is the InChIKey of 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid?
The InChIKey is FTNFWONNBSJYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O5/c16-8-7-13-1-3-14(9-11(17)18)5-6-15(4-2-13)10-12(19)20/h16H,1-10H2,(H,17,18)(H,19,20).
What are the key properties of 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid?
2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid has a molecular weight of 289.33 g/mol, XLogP of -1.93, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(carboxymethyl)-7-(2-hydroxyethyl)-1,4,7-triazonan-1-yl]acetic acid is sourced from PubChem (CID 44623582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).