C24H25N5O2 — CID 44623996
2-(diethylamino)-N-(14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-17-yl)acetamide (PubChem CID 44623996) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 2-(diethylamino)-N-(14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-17-yl)acetamide.
| Compound Name | 2-(diethylamino)-N-(14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-17-yl)acetamide |
|---|---|
| PubChem CID | 44623996 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-(diethylamino)-N-(14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-17-yl)acetamide |
| SMILES | CCN(CC)CC(=O)Nc1ccc2nc3n(c(=O)c2c1)CCc1c-3[nH]c2ccccc12 |
| InChI | InChI=1S/C24H25N5O2/c1-3-28(4-2)14-21(30)25-15-9-10-20-18(13-15)24(31)29-12-11-17-16-7-5-6-8-19(16)26-22(17)23(29)27-20/h5-10,13,26H,3-4,11-12,14H2,1-2H3,(H,25,30) |
| InChIKey | IIFLCYXLKCVJJT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|