C18H22N4O6S — CID 44624005
(2S,5R,6Z)-6-[[4-(3-aminopropylcarbamoyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 44624005) has the molecular formula C18H22N4O6S and a molecular weight of 422.46 g/mol. Its IUPAC name is (2S,5R,6Z)-6-[[4-(3-aminopropylcarbamoyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6Z)-6-[[4-(3-aminopropylcarbamoyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 44624005 |
| Molecular Formula | C18H22N4O6S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (2S,5R,6Z)-6-[[4-(3-aminopropylcarbamoyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)N2C(=O)/C(=C/c3cc(C(=O)NCCCN)ccn3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C18H22N4O6S/c1-18(2)13(17(25)26)22-15(24)12(16(22)29(18,27)28)9-11-8-10(4-7-20-11)14(23)21-6-3-5-19/h4,7-9,13,16H,3,5-6,19H2,1-2H3,(H,21,23)(H,25,26)/b12-9-/t13-,16+/m0/s1 |
| InChIKey | CEUIGYTWAXGUBI-VELOCXKFSA-N |
| XLogP | -0.63 |
| TPSA | 159.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|