C21H29N5O7S — CID 44624211
(2S,3R,5R,6Z)-3-methyl-3-[2-[methyl-[2-(methylamino)ethyl]amino]ethylcarbamoyloxymethyl]-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 44624211) has the molecular formula C21H29N5O7S and a molecular weight of 495.56 g/mol. Its IUPAC name is (2S,3R,5R,6Z)-3-methyl-3-[2-[methyl-[2-(methylamino)ethyl]amino]ethylcarbamoyloxymethyl]-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3R,5R,6Z)-3-methyl-3-[2-[methyl-[2-(methylamino)ethyl]amino]ethylcarbamoyloxymethyl]-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 44624211 |
| Molecular Formula | C21H29N5O7S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (2S,3R,5R,6Z)-3-methyl-3-[2-[methyl-[2-(methylamino)ethyl]amino]ethylcarbamoyloxymethyl]-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CNCCN(C)CCNC(=O)OC[C@@]1(C)[C@H](C(=O)O)N2C(=O)/C(=C/c3ccccn3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C21H29N5O7S/c1-21(13-33-20(30)24-9-11-25(3)10-8-22-2)16(19(28)29)26-17(27)15(18(26)34(21,31)32)12-14-6-4-5-7-23-14/h4-7,12,16,18,22H,8-11,13H2,1-3H3,(H,24,30)(H,28,29)/b15-12-/t16-,18+,21-/m0/s1 |
| InChIKey | QSCDAXGTRGTTAY-YEVGAWLCSA-N |
| XLogP | -0.85 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|