C26H29F7N2O5S — CID 44624240
(3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)methylamino]-1,1-dioxothian-4-ol (PubChem CID 44624240) has the molecular formula C26H29F7N2O5S and a molecular weight of 614.58 g/mol. Its IUPAC name is (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)methylamino]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)methylamino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 44624240 |
| Molecular Formula | C26H29F7N2O5S |
| Molecular Weight | 614.58 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-5-[(3,3-dimethyl-1H-2-benzofuran-5-yl)methylamino]-1,1-dioxothian-4-ol |
| SMILES | CC1(C)OCc2ccc(CN[C@H]3CS(=O)(=O)C[C@@H](Cc4cc(F)c(N)c(OC(C(F)(F)F)C(F)(F)F)c4)[C@@H]3O)cc21 |
| InChI | InChI=1S/C26H29F7N2O5S/c1-24(2)17-6-13(3-4-15(17)10-39-24)9-35-19-12-41(37,38)11-16(22(19)36)5-14-7-18(27)21(34)20(8-14)40-23(25(28,29)30)26(31,32)33/h3-4,6-8,16,19,22-23,35-36H,5,9-12,34H2,1-2H3/t16-,19+,22+/m1/s1 |
| InChIKey | OZOLBCYZUXLXMZ-WVBUVRCRSA-N |
| XLogP | 4.15 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|