C15H15N3O6S — CID 44624480
(2S,5R,6E)-6-(2-amino-2-oxo-1-pyridin-2-ylethylidene)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 44624480) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is (2S,5R,6E)-6-(2-amino-2-oxo-1-pyridin-2-ylethylidene)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6E)-6-(2-amino-2-oxo-1-pyridin-2-ylethylidene)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 44624480 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (2S,5R,6E)-6-(2-amino-2-oxo-1-pyridin-2-ylethylidene)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)N2C(=O)/C(=C(\C(N)=O)c3ccccn3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C15H15N3O6S/c1-15(2)10(14(21)22)18-12(20)9(13(18)25(15,23)24)8(11(16)19)7-5-3-4-6-17-7/h3-6,10,13H,1-2H3,(H2,16,19)(H,21,22)/b9-8+/t10-,13+/m0/s1 |
| InChIKey | RTLWDZXJLMLWOR-NBICGZMJSA-N |
| XLogP | -0.85 |
| TPSA | 147.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|