C14H14N2O5S — CID 44624624
(2S,5R,6Z)-3,3-dimethyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 44624624) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is (2S,5R,6Z)-3,3-dimethyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6Z)-3,3-dimethyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 44624624 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (2S,5R,6Z)-3,3-dimethyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)N2C(=O)/C(=C/c3ccccn3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C14H14N2O5S/c1-14(2)10(13(18)19)16-11(17)9(12(16)22(14,20)21)7-8-5-3-4-6-15-8/h3-7,10,12H,1-2H3,(H,18,19)/b9-7-/t10-,12+/m0/s1 |
| InChIKey | ULXVZLFWOMQRMW-PJFTZXESSA-N |
| XLogP | 0.29 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|