C27H27FN6O3S — CID 44625333
N-cyclopropyl-4-[[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-fluorophenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide (PubChem CID 44625333) has the molecular formula C27H27FN6O3S and a molecular weight of 534.62 g/mol. Its IUPAC name is N-cyclopropyl-4-[[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-fluorophenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide.
| Compound Name | N-cyclopropyl-4-[[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-fluorophenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 44625333 |
| Molecular Formula | C27H27FN6O3S |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | N-cyclopropyl-4-[[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-fluorophenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(Nc2nc3cccc(-c4ccc(CN5CCS(=O)(=O)CC5)c(F)c4)n3n2)cc1 |
| InChI | InChI=1S/C27H27FN6O3S/c28-23-16-19(4-5-20(23)17-33-12-14-38(36,37)15-13-33)24-2-1-3-25-31-27(32-34(24)25)30-22-8-6-18(7-9-22)26(35)29-21-10-11-21/h1-9,16,21H,10-15,17H2,(H,29,35)(H,30,32) |
| InChIKey | VFYBLFPVDAOAIX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |