C24H17Cl2F6LiN4O3S — CID 44625390
lithium 4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[(1R,5S)-6-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-azabicyclo[3.1.0]hexan-3-yl]-1,3-thiazole-5-carboxylate (PubChem CID 44625390) has the molecular formula C24H17Cl2F6LiN4O3S and a molecular weight of 633.33 g/mol. Its IUPAC name is lithium 4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[(1R,5S)-6-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-azabicyclo[3.1.0]hexan-3-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | lithium 4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[(1R,5S)-6-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-azabicyclo[3.1.0]hexan-3-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 44625390 |
| Molecular Formula | C24H17Cl2F6LiN4O3S |
| Molecular Weight | 633.33 g/mol |
| Exact Mass | 632.05 |
| IUPAC Name | lithium 4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[(1R,5S)-6-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-azabicyclo[3.1.0]hexan-3-yl]-1,3-thiazole-5-carboxylate |
| SMILES | Cc1[nH]c(C(=O)NC2[C@H]3CN(c4nc(Cc5cc(C(F)(F)F)cc(C(F)(F)F)c5)c(C(=O)[O-])s4)C[C@@H]23)c(Cl)c1Cl.[Li+] |
| InChI | InChI=1S/C24H18Cl2F6N4O3S.Li/c1-8-15(25)16(26)18(33-8)20(37)35-17-12-6-36(7-13(12)17)22-34-14(19(40-22)21(38)39)4-9-2-10(23(27,28)29)5-11(3-9)24(30,31)32;/h2-3,5,12-13,17,33H,4,6-7H2,1H3,(H,35,37)(H,38,39);/q;+1/p-1/t12-,13+,17?; |
| InChIKey | ZBGLBKLTXUMSHF-NOCXUEPWSA-M |
| XLogP | 1.95 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |