C28H38F4N2O5S — CID 44625397
(3S,4S,5R)-3-[[4-amino-3-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-5-fluorophenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol (PubChem CID 44625397) has the molecular formula C28H38F4N2O5S and a molecular weight of 590.68 g/mol. Its IUPAC name is (3S,4S,5R)-3-[[4-amino-3-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-5-fluorophenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[[4-amino-3-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-5-fluorophenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 44625397 |
| Molecular Formula | C28H38F4N2O5S |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | (3S,4S,5R)-3-[[4-amino-3-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-5-fluorophenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
| SMILES | CCOC[C@@H](Oc1cc(C[C@@H]2CS(=O)(=O)C[C@H](NCc3cccc(C(C)(C)C)c3)[C@H]2O)cc(F)c1N)C(F)(F)F |
| InChI | InChI=1S/C28H38F4N2O5S/c1-5-38-14-24(28(30,31)32)39-23-12-18(11-21(29)25(23)33)9-19-15-40(36,37)16-22(26(19)35)34-13-17-7-6-8-20(10-17)27(2,3)4/h6-8,10-12,19,22,24,26,34-35H,5,9,13-16,33H2,1-4H3/t19-,22+,24-,26+/m1/s1 |
| InChIKey | UJZFSYZNJMWXJO-NJONLQHESA-N |
| XLogP | 4.16 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|