About (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine
(3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine (PubChem CID 44625571) has the molecular formula C17H17Cl2NO
and a molecular weight of 322.24 g/mol. Its IUPAC name is (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine.
Molecular Properties
| Compound Name | (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine |
| PubChem CID | 44625571 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine |
| SMILES | Clc1cc(Cl)cc(O[C@H](c2ccccc2)[C@@H]2CCNC2)c1 |
| InChI | InChI=1S/C17H17Cl2NO/c18-14-8-15(19)10-16(9-14)21-17(13-6-7-20-11-13)12-4-2-1-3-5-12/h1-5,8-10,13,17,20H,6-7,11H2/t13-,17-/m1/s1 |
| InChIKey | MJNJOFYBUSUCSO-CXAGYDPISA-N |
| XLogP | 4.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine?
The IUPAC name of (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine (CID 44625571) is (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine.
What is the SMILES notation for (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine?
The canonical SMILES for (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine is Clc1cc(Cl)cc(O[C@H](c2ccccc2)[C@@H]2CCNC2)c1.
What is the InChIKey of (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine?
The InChIKey is MJNJOFYBUSUCSO-CXAGYDPISA-N. The full InChI is InChI=1S/C17H17Cl2NO/c18-14-8-15(19)10-16(9-14)21-17(13-6-7-20-11-13)12-4-2-1-3-5-12/h1-5,8-10,13,17,20H,6-7,11H2/t13-,17-/m1/s1.
What are the key properties of (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine?
(3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine has a molecular weight of 322.24 g/mol, XLogP of 4.72, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(S)-(3,5-dichlorophenoxy)-phenylmethyl]pyrrolidine is sourced from PubChem (CID 44625571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).