C27H35Cl2NO4S2 — CID 44625878
(2R,3R,4S,5R)-2-(3,4-dichlorophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-3-carboxylic acid (PubChem CID 44625878) has the molecular formula C27H35Cl2NO4S2 and a molecular weight of 572.62 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(3,4-dichlorophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3R,4S,5R)-2-(3,4-dichlorophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 44625878 |
| Molecular Formula | C27H35Cl2NO4S2 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-(3,4-dichlorophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCCCS[C@H]1[C@@H](C(=O)O)[C@H](c2ccc(Cl)c(Cl)c2)N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1CCC |
| InChI | InChI=1S/C27H35Cl2NO4S2/c1-4-6-7-8-16-35-26-23(9-5-2)30(36(33,34)20-13-10-18(3)11-14-20)25(24(26)27(31)32)19-12-15-21(28)22(29)17-19/h10-15,17,23-26H,4-9,16H2,1-3H3,(H,31,32)/t23-,24+,25+,26-/m1/s1 |
| InChIKey | XDWJZZZZQMMGMZ-KEVKATSASA-N |
| XLogP | 7.60 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|